C24H26F3N3O4 — CID 58081510
5,5,5-trifluoro-1-[3-[7-[(Z)-2-(2-methoxyethoxy)ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one (PubChem CID 58081510) has the molecular formula C24H26F3N3O4 and a molecular weight of 477.48 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[3-[7-[(Z)-2-(2-methoxyethoxy)ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-2-(2-methoxyethoxy)ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58081510 |
| Molecular Formula | C24H26F3N3O4 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 5,5,5-trifluoro-1-[3-[7-[(Z)-2-(2-methoxyethoxy)ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]pentan-2-one |
| SMILES | COCCOCCO/N=C\c1ccn2c(-c3cccc(CC(=O)CCC(F)(F)F)c3)cnc2c1 |
| InChI | InChI=1S/C24H26F3N3O4/c1-32-9-10-33-11-12-34-29-16-19-6-8-30-22(17-28-23(30)15-19)20-4-2-3-18(13-20)14-21(31)5-7-24(25,26)27/h2-4,6,8,13,15-17H,5,7,9-12,14H2,1H3/b29-16- |
| InChIKey | RYNFXXDQSQPFBH-MWLSYYOVSA-N |
| XLogP | 4.47 |
| TPSA | 74.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|