C31H33F3N4O3 — CID 76661825
1-[3-[7-[2-[benzyl(2-methoxyethyl)amino]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one (PubChem CID 76661825) has the molecular formula C31H33F3N4O3 and a molecular weight of 566.62 g/mol. Its IUPAC name is 1-[3-[7-[2-[benzyl(2-methoxyethyl)amino]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one.
| Compound Name | 1-[3-[7-[2-[benzyl(2-methoxyethyl)amino]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 76661825 |
| Molecular Formula | C31H33F3N4O3 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 1-[3-[7-[2-[benzyl(2-methoxyethyl)amino]ethoxyiminomethyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one |
| SMILES | COCCN(CCON=Cc1ccn2c(-c3cccc(CC(=O)CCC(F)(F)F)c3)cnc2c1)Cc1ccccc1 |
| InChI | InChI=1S/C31H33F3N4O3/c1-40-16-14-37(23-24-6-3-2-4-7-24)15-17-41-36-21-26-11-13-38-29(22-35-30(38)20-26)27-9-5-8-25(18-27)19-28(39)10-12-31(32,33)34/h2-9,11,13,18,20-22H,10,12,14-17,19,23H2,1H3 |
| InChIKey | HDPJYCQOEWYARJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|