C49H52N6O8 — CID 159687313
3-[4-[5,6-bis[4-(2-methoxyethoxy)phenyl]-1,2,4-triazin-3-yl]phenyl]-5,6-bis[4-(2-methoxyethoxy)phenyl]-1,2,4-triazine;methane (PubChem CID 159687313) has the molecular formula C49H52N6O8 and a molecular weight of 852.99 g/mol. Its IUPAC name is 3-[4-[5,6-bis[4-(2-methoxyethoxy)phenyl]-1,2,4-triazin-3-yl]phenyl]-5,6-bis[4-(2-methoxyethoxy)phenyl]-1,2,4-triazine;methane.
| Compound Name | 3-[4-[5,6-bis[4-(2-methoxyethoxy)phenyl]-1,2,4-triazin-3-yl]phenyl]-5,6-bis[4-(2-methoxyethoxy)phenyl]-1,2,4-triazine;methane |
|---|---|
| PubChem CID | 159687313 |
| Molecular Formula | C49H52N6O8 |
| Molecular Weight | 852.99 g/mol |
| Exact Mass | 852.38 |
| IUPAC Name | 3-[4-[5,6-bis[4-(2-methoxyethoxy)phenyl]-1,2,4-triazin-3-yl]phenyl]-5,6-bis[4-(2-methoxyethoxy)phenyl]-1,2,4-triazine;methane |
| SMILES | C.COCCOc1ccc(-c2nnc(-c3ccc(-c4nnc(-c5ccc(OCCOC)cc5)c(-c5ccc(OCCOC)cc5)n4)cc3)nc2-c2ccc(OCCOC)cc2)cc1 |
| InChI | InChI=1S/C48H48N6O8.CH4/c1-55-25-29-59-39-17-9-33(10-18-39)43-45(35-13-21-41(22-14-35)61-31-27-57-3)51-53-47(49-43)37-5-7-38(8-6-37)48-50-44(34-11-19-40(20-12-34)60-30-26-56-2)46(52-54-48)36-15-23-42(24-16-36)62-32-28-58-4;/h5-24H,25-32H2,1-4H3;1H4 |
| InChIKey | MVYPWCRHNUEVKY-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 151.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.99 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|