About zinc;indium(3+);phosphate
zinc;indium(3+);phosphate (PubChem CID 159690150) has the molecular formula InO4PZn+2
and a molecular weight of 275.18 g/mol. Its IUPAC name is zinc;indium(3+);phosphate.
Molecular Properties
| Compound Name | zinc;indium(3+);phosphate |
| PubChem CID | 159690150 |
| Molecular Formula | InO4PZn+2 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 273.79 |
| IUPAC Name | zinc;indium(3+);phosphate |
| SMILES | O=P([O-])([O-])[O-].[In+3].[Zn+2] |
| InChI | InChI=1S/In.H3O4P.Zn/c;1-5(2,3)4;/h;(H3,1,2,3,4);/q+3;;+2/p-3 |
| InChIKey | SNNPVKQELMDCGZ-UHFFFAOYSA-K |
| XLogP | -3.21 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc;indium(3+);phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;indium(3+);phosphate?
The IUPAC name of zinc;indium(3+);phosphate (CID 159690150) is zinc;indium(3+);phosphate.
What is the SMILES notation for zinc;indium(3+);phosphate?
The canonical SMILES for zinc;indium(3+);phosphate is O=P([O-])([O-])[O-].[In+3].[Zn+2].
What is the InChIKey of zinc;indium(3+);phosphate?
The InChIKey is SNNPVKQELMDCGZ-UHFFFAOYSA-K. The full InChI is InChI=1S/In.H3O4P.Zn/c;1-5(2,3)4;/h;(H3,1,2,3,4);/q+3;;+2/p-3.
What are the key properties of zinc;indium(3+);phosphate?
zinc;indium(3+);phosphate has a molecular weight of 275.18 g/mol, XLogP of -3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;indium(3+);phosphate is sourced from PubChem (CID 159690150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).