About zirconium diphosphate
zirconium diphosphate (PubChem CID 3014757) has the molecular formula O8P2Zr-6
and a molecular weight of 281.16 g/mol. Its IUPAC name is zirconium diphosphate.
Molecular Properties
| Compound Name | zirconium diphosphate |
| PubChem CID | 3014757 |
| Molecular Formula | O8P2Zr-6 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 279.81 |
| IUPAC Name | zirconium diphosphate |
| SMILES | O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Zr] |
| InChI | InChI=1S/2H3O4P.Zr/c2*1-5(2,3)4;/h2*(H3,1,2,3,4);/p-6 |
| InChIKey | JTXXKLNSXNKCBI-UHFFFAOYSA-H |
| XLogP | -5.65 |
| TPSA | 172.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zirconium diphosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zirconium diphosphate?
The IUPAC name of zirconium diphosphate (CID 3014757) is zirconium diphosphate.
What is the SMILES notation for zirconium diphosphate?
The canonical SMILES for zirconium diphosphate is O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Zr].
What is the InChIKey of zirconium diphosphate?
The InChIKey is JTXXKLNSXNKCBI-UHFFFAOYSA-H. The full InChI is InChI=1S/2H3O4P.Zr/c2*1-5(2,3)4;/h2*(H3,1,2,3,4);/p-6.
What are the key properties of zirconium diphosphate?
zirconium diphosphate has a molecular weight of 281.16 g/mol, XLogP of -5.65, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for zirconium diphosphate is sourced from PubChem (CID 3014757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).