About CID 23618830
CID 23618830 (PubChem CID 23618830) has the molecular formula CaO8P2-6
and a molecular weight of 230.02 g/mol.
Molecular Properties
| Compound Name | CID 23618830 |
| PubChem CID | 23618830 |
| Molecular Formula | CaO8P2-6 |
| Molecular Weight | 230.02 g/mol |
| Exact Mass | 229.87 |
| IUPAC Name | — |
| SMILES | O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Ca] |
| InChI | InChI=1S/Ca.2H3O4P/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/p-6 |
| InChIKey | PGBVWURQHRYYHB-UHFFFAOYSA-H |
| XLogP | -6.03 |
| TPSA | 172.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.02 |
| LogP ≤ 5 | -6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 23618830 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23618830?
The IUPAC name of CID 23618830 (CID 23618830) is not available.
What is the SMILES notation for CID 23618830?
The canonical SMILES for CID 23618830 is O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Ca].
What is the InChIKey of CID 23618830?
The InChIKey is PGBVWURQHRYYHB-UHFFFAOYSA-H. The full InChI is InChI=1S/Ca.2H3O4P/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/p-6.
What are the key properties of CID 23618830?
CID 23618830 has a molecular weight of 230.02 g/mol, XLogP of -6.03, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23618830 is sourced from PubChem (CID 23618830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).