C15H30O6 — CID 159693212
6-(hydroxymethyl)-2,4,5-tri(propan-2-yloxy)oxan-3-ol (PubChem CID 159693212) has the molecular formula C15H30O6 and a molecular weight of 306.40 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2,4,5-tri(propan-2-yloxy)oxan-3-ol.
| Compound Name | 6-(hydroxymethyl)-2,4,5-tri(propan-2-yloxy)oxan-3-ol |
|---|---|
| PubChem CID | 159693212 |
| Molecular Formula | C15H30O6 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 6-(hydroxymethyl)-2,4,5-tri(propan-2-yloxy)oxan-3-ol |
| SMILES | CC(C)OC1OC(CO)C(OC(C)C)C(OC(C)C)C1O |
| InChI | InChI=1S/C15H30O6/c1-8(2)18-13-11(7-16)21-15(20-10(5)6)12(17)14(13)19-9(3)4/h8-17H,7H2,1-6H3 |
| InChIKey | MWRFFALQIOCULO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |