C9H18O5S — CID 20638905
(2R,3S,4S,5S)-2-(hydroxymethyl)-6-propan-2-yloxy-4-sulfanyloxane-3,5-diol (PubChem CID 20638905) has the molecular formula C9H18O5S and a molecular weight of 238.31 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-(hydroxymethyl)-6-propan-2-yloxy-4-sulfanyloxane-3,5-diol.
| Compound Name | (2R,3S,4S,5S)-2-(hydroxymethyl)-6-propan-2-yloxy-4-sulfanyloxane-3,5-diol |
|---|---|
| PubChem CID | 20638905 |
| Molecular Formula | C9H18O5S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (2R,3S,4S,5S)-2-(hydroxymethyl)-6-propan-2-yloxy-4-sulfanyloxane-3,5-diol |
| SMILES | CC(C)OC1O[C@H](CO)[C@H](O)[C@H](S)[C@H]1O |
| InChI | InChI=1S/C9H18O5S/c1-4(2)13-9-7(12)8(15)6(11)5(3-10)14-9/h4-12,15H,3H2,1-2H3/t5-,6+,7-,8+,9?/m1/s1 |
| InChIKey | ZLAVGZTZQQBEFL-LOHXVAINSA-N |
| XLogP | -0.85 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|