C24H39N3O11 — CID 159699542
(2R,3R,4R)-4-(diaminomethylideneamino)-2-[(1R,2R)-2,3-dihydroxy-1-[4-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]butanoyloxy]propyl]-3-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 159699542) has the molecular formula C24H39N3O11 and a molecular weight of 545.59 g/mol. Its IUPAC name is (2R,3R,4R)-4-(diaminomethylideneamino)-2-[(1R,2R)-2,3-dihydroxy-1-[4-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]butanoyloxy]propyl]-3-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4R)-4-(diaminomethylideneamino)-2-[(1R,2R)-2,3-dihydroxy-1-[4-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]butanoyloxy]propyl]-3-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 159699542 |
| Molecular Formula | C24H39N3O11 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | (2R,3R,4R)-4-(diaminomethylideneamino)-2-[(1R,2R)-2,3-dihydroxy-1-[4-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]butanoyloxy]propyl]-3-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | C#CCOCCOCCOCCOCCCC(=O)O[C@@H]([C@@H]1OC(C(=O)O)=C[C@H](N=C(N)N)[C@H]1C)[C@H](O)CO |
| InChI | InChI=1S/C24H39N3O11/c1-3-6-33-8-10-35-12-13-36-11-9-34-7-4-5-20(30)38-22(18(29)15-28)21-16(2)17(27-24(25)26)14-19(37-21)23(31)32/h1,14,16-18,21-22,28-29H,4-13,15H2,2H3,(H,31,32)(H4,25,26,27)/t16-,17+,18-,21-,22-/m1/s1 |
| InChIKey | MXLFRZSAISMSQL-PEWUMXJESA-N |
| XLogP | -1.62 |
| TPSA | 214.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|