About carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide
carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide (PubChem CID 159703644) has the molecular formula C17H16BrN5
and a molecular weight of 370.25 g/mol. Its IUPAC name is carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide.
Molecular Properties
| Compound Name | carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide |
| PubChem CID | 159703644 |
| Molecular Formula | C17H16BrN5 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide |
| SMILES | CC(C)c1cc(-c2ccc(C#N)n2C)ccc1NC#N.N#CBr |
| InChI | InChI=1S/C16H16N4.CBrN/c1-11(2)14-8-12(4-6-15(14)19-10-18)16-7-5-13(9-17)20(16)3;2-1-3/h4-8,11,19H,1-3H3; |
| InChIKey | MXXYKMQXEUBPOT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide?
The IUPAC name of carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide (CID 159703644) is carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide.
What is the SMILES notation for carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide?
The canonical SMILES for carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide is CC(C)c1cc(-c2ccc(C#N)n2C)ccc1NC#N.N#CBr.
What is the InChIKey of carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide?
The InChIKey is MXXYKMQXEUBPOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4.CBrN/c1-11(2)14-8-12(4-6-15(14)19-10-18)16-7-5-13(9-17)20(16)3;2-1-3/h4-8,11,19H,1-3H3;.
What are the key properties of carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide?
carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide has a molecular weight of 370.25 g/mol, XLogP of 4.44, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbononitridic bromide;[4-(5-cyano-1-methylpyrrol-2-yl)-2-propan-2-ylphenyl]cyanamide is sourced from PubChem (CID 159703644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).