C10H10N4 — CID 54248060
[5-(cyanoamino)-2,4-dimethylphenyl]cyanamide (PubChem CID 54248060) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is [5-(cyanoamino)-2,4-dimethylphenyl]cyanamide.
| Compound Name | [5-(cyanoamino)-2,4-dimethylphenyl]cyanamide |
|---|---|
| PubChem CID | 54248060 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | [5-(cyanoamino)-2,4-dimethylphenyl]cyanamide |
| SMILES | Cc1cc(C)c(NC#N)cc1NC#N |
| InChI | InChI=1S/C10H10N4/c1-7-3-8(2)10(14-6-12)4-9(7)13-5-11/h3-4,13-14H,1-2H3 |
| InChIKey | QUSGJXIGAHUQFY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|