About methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one
methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one (PubChem CID 159704990) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one |
| PubChem CID | 159704990 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one |
| SMILES | C.C.C=C(C)C1CCCN1C(=O)C(C)C |
| InChI | InChI=1S/C11H19NO.2CH4/c1-8(2)10-6-5-7-12(10)11(13)9(3)4;;/h9-10H,1,5-7H2,2-4H3;2*1H4 |
| InChIKey | MYCFFVCJKLFBFI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one?
The IUPAC name of methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one (CID 159704990) is methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one.
What is the SMILES notation for methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one?
The canonical SMILES for methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one is C.C.C=C(C)C1CCCN1C(=O)C(C)C.
What is the InChIKey of methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one?
The InChIKey is MYCFFVCJKLFBFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO.2CH4/c1-8(2)10-6-5-7-12(10)11(13)9(3)4;;/h9-10H,1,5-7H2,2-4H3;2*1H4.
What are the key properties of methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one?
methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one has a molecular weight of 213.36 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methyl-1-(2-prop-1-en-2-ylpyrrolidin-1-yl)propan-1-one is sourced from PubChem (CID 159704990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).