About azanium;copper;silicate
azanium;copper;silicate (PubChem CID 159705008) has the molecular formula H4CuNO4Si-3
and a molecular weight of 173.67 g/mol. Its IUPAC name is azanium;copper;silicate.
Molecular Properties
| Compound Name | azanium;copper;silicate |
| PubChem CID | 159705008 |
| Molecular Formula | H4CuNO4Si-3 |
| Molecular Weight | 173.67 g/mol |
| Exact Mass | 172.92 |
| IUPAC Name | azanium;copper;silicate |
| SMILES | [Cu].[NH4+].[O-][Si]([O-])([O-])[O-] |
| InChI | InChI=1S/Cu.H3N.O4Si/c;;1-5(2,3)4/h;1H3;/q;;-4/p+1 |
| InChIKey | LXMRMLYMCHVNLP-UHFFFAOYSA-O |
| XLogP | -4.76 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.67 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azanium;copper;silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;copper;silicate?
The IUPAC name of azanium;copper;silicate (CID 159705008) is azanium;copper;silicate.
What is the SMILES notation for azanium;copper;silicate?
The canonical SMILES for azanium;copper;silicate is [Cu].[NH4+].[O-][Si]([O-])([O-])[O-].
What is the InChIKey of azanium;copper;silicate?
The InChIKey is LXMRMLYMCHVNLP-UHFFFAOYSA-O. The full InChI is InChI=1S/Cu.H3N.O4Si/c;;1-5(2,3)4/h;1H3;/q;;-4/p+1.
What are the key properties of azanium;copper;silicate?
azanium;copper;silicate has a molecular weight of 173.67 g/mol, XLogP of -4.76, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;copper;silicate is sourced from PubChem (CID 159705008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).