About azanium;iron(3+);silicate
azanium;iron(3+);silicate (PubChem CID 174943362) has the molecular formula H4FeNO4Si
and a molecular weight of 165.97 g/mol. Its IUPAC name is azanium;iron(3+);silicate.
Molecular Properties
| Compound Name | azanium;iron(3+);silicate |
| PubChem CID | 174943362 |
| Molecular Formula | H4FeNO4Si |
| Molecular Weight | 165.97 g/mol |
| Exact Mass | 165.93 |
| IUPAC Name | azanium;iron(3+);silicate |
| SMILES | [Fe+3].[NH4+].[O-][Si]([O-])([O-])[O-] |
| InChI | InChI=1S/Fe.H3N.O4Si/c;;1-5(2,3)4/h;1H3;/q+3;;-4/p+1 |
| InChIKey | NXXHMVYVHNIWAP-UHFFFAOYSA-O |
| XLogP | -4.76 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.97 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azanium;iron(3+);silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;iron(3+);silicate?
The IUPAC name of azanium;iron(3+);silicate (CID 174943362) is azanium;iron(3+);silicate.
What is the SMILES notation for azanium;iron(3+);silicate?
The canonical SMILES for azanium;iron(3+);silicate is [Fe+3].[NH4+].[O-][Si]([O-])([O-])[O-].
What is the InChIKey of azanium;iron(3+);silicate?
The InChIKey is NXXHMVYVHNIWAP-UHFFFAOYSA-O. The full InChI is InChI=1S/Fe.H3N.O4Si/c;;1-5(2,3)4/h;1H3;/q+3;;-4/p+1.
What are the key properties of azanium;iron(3+);silicate?
azanium;iron(3+);silicate has a molecular weight of 165.97 g/mol, XLogP of -4.76, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;iron(3+);silicate is sourced from PubChem (CID 174943362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).