C33H58O3 — CID 159708729
2-methylbut-2-ene;2-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butanal;2-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butanoic acid (PubChem CID 159708729) has the molecular formula C33H58O3 and a molecular weight of 502.82 g/mol. Its IUPAC name is 2-methylbut-2-ene;2-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butanal;2-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butanoic acid.
| Compound Name | 2-methylbut-2-ene;2-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butanal;2-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butanoic acid |
|---|---|
| PubChem CID | 159708729 |
| Molecular Formula | C33H58O3 |
| Molecular Weight | 502.82 g/mol |
| Exact Mass | 502.44 |
| IUPAC Name | 2-methylbut-2-ene;2-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butanal;2-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butanoic acid |
| SMILES | CC1=CCCC(C)(C)C1CCC(C)C(=O)O.CC1=CCCC(C)(C)C1CCC(C)C=O.CC=C(C)C |
| InChI | InChI=1S/C14H24O2.C14H24O.C5H10/c1-10-6-5-9-14(3,4)12(10)8-7-11(2)13(15)16;1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4;1-4-5(2)3/h6,11-12H,5,7-9H2,1-4H3,(H,15,16);6,10-11,13H,5,7-9H2,1-4H3;4H,1-3H3 |
| InChIKey | MYODDLUNCCKYRU-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.82 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|