C16H25N — CID 71323427
2,3-dimethyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)pent-2-enenitrile (PubChem CID 71323427) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 2,3-dimethyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)pent-2-enenitrile.
| Compound Name | 2,3-dimethyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)pent-2-enenitrile |
|---|---|
| PubChem CID | 71323427 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 2,3-dimethyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)pent-2-enenitrile |
| SMILES | CC1=CCCC(C)(C)C1CCC(C)=C(C)C#N |
| InChI | InChI=1S/C16H25N/c1-12(14(3)11-17)8-9-15-13(2)7-6-10-16(15,4)5/h7,15H,6,8-10H2,1-5H3 |
| InChIKey | ZDHGIHALIOBZNI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|