C26H36O2 — CID 85189818
2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,6-dienyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 85189818) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,6-dienyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,6-dienyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 85189818 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,6-dienyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(=CCC1=CC(=O)C=CC1=O)CCC=C(C)CCC1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C26H36O2/c1-19(11-13-22-18-23(27)14-16-25(22)28)8-6-9-20(2)12-15-24-21(3)10-7-17-26(24,4)5/h9-11,14,16,18,24H,6-8,12-13,15,17H2,1-5H3 |
| InChIKey | FSCBWLVZXWNRCO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|