C30H43N5O2 — CID 159715166
3,5-ditert-butyl-2-hydroxybenzonitrile;2,4-ditert-butyl-6-(2H-tetrazol-5-yl)phenol (PubChem CID 159715166) has the molecular formula C30H43N5O2 and a molecular weight of 505.71 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-hydroxybenzonitrile;2,4-ditert-butyl-6-(2H-tetrazol-5-yl)phenol.
| Compound Name | 3,5-ditert-butyl-2-hydroxybenzonitrile;2,4-ditert-butyl-6-(2H-tetrazol-5-yl)phenol |
|---|---|
| PubChem CID | 159715166 |
| Molecular Formula | C30H43N5O2 |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.34 |
| IUPAC Name | 3,5-ditert-butyl-2-hydroxybenzonitrile;2,4-ditert-butyl-6-(2H-tetrazol-5-yl)phenol |
| SMILES | CC(C)(C)c1cc(-c2nn[nH]n2)c(O)c(C(C)(C)C)c1.CC(C)(C)c1cc(C#N)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H22N4O.C15H21NO/c1-14(2,3)9-7-10(13-16-18-19-17-13)12(20)11(8-9)15(4,5)6;1-14(2,3)11-7-10(9-16)13(17)12(8-11)15(4,5)6/h7-8,20H,1-6H3,(H,16,17,18,19);7-8,17H,1-6H3 |
| InChIKey | MZIKBYHIKYNMMH-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |