C30H45ClN8O8 — CID 159718083
tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-[(5-nitro-2-pyridinyl)amino]piperidine-1-carboxylate;2-chloro-5-nitropyridine (PubChem CID 159718083) has the molecular formula C30H45ClN8O8 and a molecular weight of 681.19 g/mol. Its IUPAC name is tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-[(5-nitro-2-pyridinyl)amino]piperidine-1-carboxylate;2-chloro-5-nitropyridine.
| Compound Name | tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-[(5-nitro-2-pyridinyl)amino]piperidine-1-carboxylate;2-chloro-5-nitropyridine |
|---|---|
| PubChem CID | 159718083 |
| Molecular Formula | C30H45ClN8O8 |
| Molecular Weight | 681.19 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-[(5-nitro-2-pyridinyl)amino]piperidine-1-carboxylate;2-chloro-5-nitropyridine |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)CC1.CC(C)(C)OC(=O)N1CCC(Nc2ccc([N+](=O)[O-])cn2)CC1.O=[N+]([O-])c1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H22N4O4.C10H20N2O2.C5H3ClN2O2/c1-15(2,3)23-14(20)18-8-6-11(7-9-18)17-13-5-4-12(10-16-13)19(21)22;1-10(2,3)14-9(13)12-6-4-8(11)5-7-12;6-5-2-1-4(3-7-5)8(9)10/h4-5,10-11H,6-9H2,1-3H3,(H,16,17);8H,4-7,11H2,1-3H3;1-3H |
| InChIKey | MZRLCOUMWGRBPN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 209.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.19 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|