C21H33N5O2 — CID 159721895
tert-butyl (3R)-4-[5-(2-isocyanopropan-2-yl)-4-methylpyrimidin-2-yl]-3-propan-2-ylpiperazine-1-carboxylate (PubChem CID 159721895) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is tert-butyl (3R)-4-[5-(2-isocyanopropan-2-yl)-4-methylpyrimidin-2-yl]-3-propan-2-ylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-[5-(2-isocyanopropan-2-yl)-4-methylpyrimidin-2-yl]-3-propan-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 159721895 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | tert-butyl (3R)-4-[5-(2-isocyanopropan-2-yl)-4-methylpyrimidin-2-yl]-3-propan-2-ylpiperazine-1-carboxylate |
| SMILES | [C-]#[N+]C(C)(C)c1cnc(N2CCN(C(=O)OC(C)(C)C)C[C@H]2C(C)C)nc1C |
| InChI | InChI=1S/C21H33N5O2/c1-14(2)17-13-25(19(27)28-20(4,5)6)10-11-26(17)18-23-12-16(15(3)24-18)21(7,8)22-9/h12,14,17H,10-11,13H2,1-8H3/t17-/m0/s1 |
| InChIKey | DVUGEAUXIPRDEZ-KRWDZBQOSA-N |
| XLogP | 4.02 |
| TPSA | 62.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|