C90H54BF4N10 — CID 159722355
CID 159722355 (PubChem CID 159722355) has the molecular formula C90H54BF4N10 and a molecular weight of 1362.30 g/mol.
| Compound Name | CID 159722355 |
|---|---|
| PubChem CID | 159722355 |
| Molecular Formula | C90H54BF4N10 |
| Molecular Weight | 1362.30 g/mol |
| Exact Mass | 1361.46 |
| IUPAC Name | — |
| SMILES | Fc1nc(F)c(F)c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c1F.[B].c1ccc(-c2cc(-c3ccccc3)nc(-c3c(-n4c5ccccc5c5ccccc54)c(-n4c5ccccc5c5ccccc54)nc(-n4c5ccccc5c5ccccc54)c3-n3c4ccccc4c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C69H43N7.C21H11F4N3.B/c1-3-23-44(24-4-1)54-43-55(45-25-5-2-6-26-45)71-67(70-54)64-65(73-56-35-15-7-27-46(56)47-28-8-16-36-57(47)73)68(75-60-39-19-11-31-50(60)51-32-12-20-40-61(51)75)72-69(76-62-41-21-13-33-52(62)53-34-14-22-42-63(53)76)66(64)74-58-37-17-9-29-48(58)49-30-10-18-38-59(49)74;22-17-16(18(23)20(25)28-19(17)24)21-26-14(12-7-3-1-4-8-12)11-15(27-21)13-9-5-2-6-10-13;/h1-43H;1-11H; |
| InChIKey | YPCHVGOSJVMHDR-UHFFFAOYSA-N |
| XLogP | 22.31 |
| TPSA | 97.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 105 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1362.30 |
| LogP ≤ 5 | 22.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|