C62H42N8 — CID 146472248
2,5-di(carbazol-9-yl)-3,6-bis(4,6-diphenylpyrimidin-2-yl)benzene-1,4-diamine (PubChem CID 146472248) has the molecular formula C62H42N8 and a molecular weight of 899.07 g/mol. Its IUPAC name is 2,5-di(carbazol-9-yl)-3,6-bis(4,6-diphenylpyrimidin-2-yl)benzene-1,4-diamine.
| Compound Name | 2,5-di(carbazol-9-yl)-3,6-bis(4,6-diphenylpyrimidin-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 146472248 |
| Molecular Formula | C62H42N8 |
| Molecular Weight | 899.07 g/mol |
| Exact Mass | 898.35 |
| IUPAC Name | 2,5-di(carbazol-9-yl)-3,6-bis(4,6-diphenylpyrimidin-2-yl)benzene-1,4-diamine |
| SMILES | Nc1c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c(-n2c3ccccc3c3ccccc32)c(N)c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C62H42N8/c63-57-55(61-65-47(39-21-5-1-6-22-39)37-48(66-61)40-23-7-2-8-24-40)59(69-51-33-17-13-29-43(51)44-30-14-18-34-52(44)69)58(64)56(60(57)70-53-35-19-15-31-45(53)46-32-16-20-36-54(46)70)62-67-49(41-25-9-3-10-26-41)38-50(68-62)42-27-11-4-12-28-42/h1-38H,63-64H2 |
| InChIKey | PXZLTCCPDNCAIC-UHFFFAOYSA-N |
| XLogP | 14.63 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.07 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|