C11H7BrF2O2 — CID 159725762
(2E)-5-(4-bromo-2,6-difluorophenyl)penta-2,4-dienoic acid (PubChem CID 159725762) has the molecular formula C11H7BrF2O2 and a molecular weight of 289.08 g/mol. Its IUPAC name is (2E)-5-(4-bromo-2,6-difluorophenyl)penta-2,4-dienoic acid.
| Compound Name | (2E)-5-(4-bromo-2,6-difluorophenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 159725762 |
| Molecular Formula | C11H7BrF2O2 |
| Molecular Weight | 289.08 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | (2E)-5-(4-bromo-2,6-difluorophenyl)penta-2,4-dienoic acid |
| SMILES | O=C(O)/C=C/C=Cc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H7BrF2O2/c12-7-5-9(13)8(10(14)6-7)3-1-2-4-11(15)16/h1-6H,(H,15,16)/b3-1?,4-2+ |
| InChIKey | NAPNDZOGDGSOSU-RWOTWAKKSA-N |
| XLogP | 3.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|