C50H52N14O6 — CID 159727855
6-ethenyl-1-methyl-7-nitroindazole;6-ethenyl-2-methyl-7-nitroindazole;6-ethenyl-7-nitro-1H-isoindole;bis(6-ethyl-2-methylindazol-7-amine) (PubChem CID 159727855) has the molecular formula C50H52N14O6 and a molecular weight of 945.06 g/mol. Its IUPAC name is 6-ethenyl-1-methyl-7-nitroindazole;6-ethenyl-2-methyl-7-nitroindazole;6-ethenyl-7-nitro-1H-isoindole;bis(6-ethyl-2-methylindazol-7-amine).
| Compound Name | 6-ethenyl-1-methyl-7-nitroindazole;6-ethenyl-2-methyl-7-nitroindazole;6-ethenyl-7-nitro-1H-isoindole;bis(6-ethyl-2-methylindazol-7-amine) |
|---|---|
| PubChem CID | 159727855 |
| Molecular Formula | C50H52N14O6 |
| Molecular Weight | 945.06 g/mol |
| Exact Mass | 944.42 |
| IUPAC Name | 6-ethenyl-1-methyl-7-nitroindazole;6-ethenyl-2-methyl-7-nitroindazole;6-ethenyl-7-nitro-1H-isoindole;bis(6-ethyl-2-methylindazol-7-amine) |
| SMILES | C=Cc1ccc2c(c1[N+](=O)[O-])CN=C2.C=Cc1ccc2cn(C)nc2c1[N+](=O)[O-].C=Cc1ccc2cnn(C)c2c1[N+](=O)[O-].CCc1ccc2cn(C)nc2c1N.CCc1ccc2cn(C)nc2c1N |
| InChI | InChI=1S/2C10H9N3O2.2C10H13N3.C10H8N2O2/c1-3-7-4-5-8-6-12(2)11-9(8)10(7)13(14)15;1-3-7-4-5-8-6-11-12(2)9(8)10(7)13(14)15;2*1-3-7-4-5-8-6-13(2)12-10(8)9(7)11;1-2-7-3-4-8-5-11-6-9(8)10(7)12(13)14/h2*3-6H,1H2,2H3;2*4-6H,3,11H2,1-2H3;2-5H,1,6H2 |
| InChIKey | NAVYZXQSFVPRLN-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 265.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.06 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|