C15H18N4O3 — CID 146093218
N,4-diethyl-N-(1-methylpyrazol-4-yl)-3-nitrobenzamide (PubChem CID 146093218) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is N,4-diethyl-N-(1-methylpyrazol-4-yl)-3-nitrobenzamide.
| Compound Name | N,4-diethyl-N-(1-methylpyrazol-4-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 146093218 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N,4-diethyl-N-(1-methylpyrazol-4-yl)-3-nitrobenzamide |
| SMILES | CCc1ccc(C(=O)N(CC)c2cnn(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N4O3/c1-4-11-6-7-12(8-14(11)19(21)22)15(20)18(5-2)13-9-16-17(3)10-13/h6-10H,4-5H2,1-3H3 |
| InChIKey | WZQSSKQUTOONRQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|