C14H31N3O2S — CID 159728961
2,6-dimethylmorpholine;morpholine;thiomorpholine (PubChem CID 159728961) has the molecular formula C14H31N3O2S and a molecular weight of 305.49 g/mol. Its IUPAC name is 2,6-dimethylmorpholine;morpholine;thiomorpholine.
| Compound Name | 2,6-dimethylmorpholine;morpholine;thiomorpholine |
|---|---|
| PubChem CID | 159728961 |
| Molecular Formula | C14H31N3O2S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 2,6-dimethylmorpholine;morpholine;thiomorpholine |
| SMILES | C1COCCN1.C1CSCCN1.CC1CNCC(C)O1 |
| InChI | InChI=1S/C6H13NO.C4H9NO.C4H9NS/c1-5-3-7-4-6(2)8-5;2*1-3-6-4-2-5-1/h5-7H,3-4H2,1-2H3;2*5H,1-4H2 |
| InChIKey | NAZLQTZBVWJAON-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |