About 2,6-dimethylmorpholine;propane
2,6-dimethylmorpholine;propane (PubChem CID 143985013) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is 2,6-dimethylmorpholine;propane.
Molecular Properties
| Compound Name | 2,6-dimethylmorpholine;propane |
| PubChem CID | 143985013 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | 2,6-dimethylmorpholine;propane |
| SMILES | CC1CNCC(C)O1.CCC |
| InChI | InChI=1S/C6H13NO.C3H8/c1-5-3-7-4-6(2)8-5;1-3-2/h5-7H,3-4H2,1-2H3;3H2,1-2H3 |
| InChIKey | LTAWIORFZPMBFL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethylmorpholine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylmorpholine;propane?
The IUPAC name of 2,6-dimethylmorpholine;propane (CID 143985013) is 2,6-dimethylmorpholine;propane.
What is the SMILES notation for 2,6-dimethylmorpholine;propane?
The canonical SMILES for 2,6-dimethylmorpholine;propane is CC1CNCC(C)O1.CCC.
What is the InChIKey of 2,6-dimethylmorpholine;propane?
The InChIKey is LTAWIORFZPMBFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C3H8/c1-5-3-7-4-6(2)8-5;1-3-2/h5-7H,3-4H2,1-2H3;3H2,1-2H3.
What are the key properties of 2,6-dimethylmorpholine;propane?
2,6-dimethylmorpholine;propane has a molecular weight of 159.27 g/mol, XLogP of 1.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylmorpholine;propane is sourced from PubChem (CID 143985013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).