C15H33NO — CID 144929600
(2S,6R)-2,6-dimethylmorpholine;ethane;methylcyclohexane (PubChem CID 144929600) has the molecular formula C15H33NO and a molecular weight of 243.43 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethylmorpholine;ethane;methylcyclohexane.
| Compound Name | (2S,6R)-2,6-dimethylmorpholine;ethane;methylcyclohexane |
|---|---|
| PubChem CID | 144929600 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | (2S,6R)-2,6-dimethylmorpholine;ethane;methylcyclohexane |
| SMILES | CC.CC1CCCCC1.C[C@@H]1CNC[C@H](C)O1 |
| InChI | InChI=1S/C7H14.C6H13NO.C2H6/c1-7-5-3-2-4-6-7;1-5-3-7-4-6(2)8-5;1-2/h7H,2-6H2,1H3;5-7H,3-4H2,1-2H3;1-2H3/t;5-,6+; |
| InChIKey | ZVWBJJPVOWWUNI-GCTAOFAESA-N |
| XLogP | 4.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |