About disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate
disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate (PubChem CID 159730003) has the molecular formula C15H15NNa2O3S
and a molecular weight of 335.34 g/mol. Its IUPAC name is disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate.
Molecular Properties
| Compound Name | disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate |
| PubChem CID | 159730003 |
| Molecular Formula | C15H15NNa2O3S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate |
| SMILES | C[O-].O=C([O-])C(SCc1ccncc1)c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C14H13NO2S.CH3O.2Na/c16-14(17)13(12-4-2-1-3-5-12)18-10-11-6-8-15-9-7-11;1-2;;/h1-9,13H,10H2,(H,16,17);1H3;;/q;-1;2*+1/p-1 |
| InChIKey | NBCULKQCKFQTOI-UHFFFAOYSA-M |
| XLogP | -5.21 |
| TPSA | 76.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | -5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate?
The IUPAC name of disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate (CID 159730003) is disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate.
What is the SMILES notation for disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate?
The canonical SMILES for disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate is C[O-].O=C([O-])C(SCc1ccncc1)c1ccccc1.[Na+].[Na+].
What is the InChIKey of disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate?
The InChIKey is NBCULKQCKFQTOI-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H13NO2S.CH3O.2Na/c16-14(17)13(12-4-2-1-3-5-12)18-10-11-6-8-15-9-7-11;1-2;;/h1-9,13H,10H2,(H,16,17);1H3;;/q;-1;2*+1/p-1.
What are the key properties of disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate?
disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate has a molecular weight of 335.34 g/mol, XLogP of -5.21, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;methanolate;2-phenyl-2-(pyridin-4-ylmethylsulfanyl)acetate is sourced from PubChem (CID 159730003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).