About 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole
1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole (PubChem CID 159730483) has the molecular formula C15H11Br2F2N
and a molecular weight of 403.06 g/mol. Its IUPAC name is 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole.
Molecular Properties
| Compound Name | 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole |
| PubChem CID | 159730483 |
| Molecular Formula | C15H11Br2F2N |
| Molecular Weight | 403.06 g/mol |
| Exact Mass | 400.92 |
| IUPAC Name | 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole |
| SMILES | Cn1ccc2cc(Br)c(F)cc21.Fc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H7BrFN.C6H4BrF/c1-12-3-2-6-4-7(10)8(11)5-9(6)12;7-5-1-3-6(8)4-2-5/h2-5H,1H3;1-4H |
| InChIKey | NBEFZQUMVOKYIW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.06 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole?
The IUPAC name of 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole (CID 159730483) is 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole.
What is the SMILES notation for 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole?
The canonical SMILES for 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole is Cn1ccc2cc(Br)c(F)cc21.Fc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole?
The InChIKey is NBEFZQUMVOKYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrFN.C6H4BrF/c1-12-3-2-6-4-7(10)8(11)5-9(6)12;7-5-1-3-6(8)4-2-5/h2-5H,1H3;1-4H.
What are the key properties of 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole?
1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole has a molecular weight of 403.06 g/mol, XLogP of 5.67, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-fluorobenzene;5-bromo-6-fluoro-1-methylindole is sourced from PubChem (CID 159730483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).