About sulfoformic acid;thiophene
sulfoformic acid;thiophene (PubChem CID 159730608) has the molecular formula C5H6O5S2
and a molecular weight of 210.23 g/mol. Its IUPAC name is sulfoformic acid;thiophene.
Molecular Properties
| Compound Name | sulfoformic acid;thiophene |
| PubChem CID | 159730608 |
| Molecular Formula | C5H6O5S2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 209.97 |
| IUPAC Name | sulfoformic acid;thiophene |
| SMILES | O=C(O)S(=O)(=O)O.c1ccsc1 |
| InChI | InChI=1S/C4H4S.CH2O5S/c1-2-4-5-3-1;2-1(3)7(4,5)6/h1-4H;(H,2,3)(H,4,5,6) |
| InChIKey | NBENBKHLEFFXIM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze sulfoformic acid;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfoformic acid;thiophene?
The IUPAC name of sulfoformic acid;thiophene (CID 159730608) is sulfoformic acid;thiophene.
What is the SMILES notation for sulfoformic acid;thiophene?
The canonical SMILES for sulfoformic acid;thiophene is O=C(O)S(=O)(=O)O.c1ccsc1.
What is the InChIKey of sulfoformic acid;thiophene?
The InChIKey is NBENBKHLEFFXIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4S.CH2O5S/c1-2-4-5-3-1;2-1(3)7(4,5)6/h1-4H;(H,2,3)(H,4,5,6).
What are the key properties of sulfoformic acid;thiophene?
sulfoformic acid;thiophene has a molecular weight of 210.23 g/mol, XLogP of 1.30, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfoformic acid;thiophene is sourced from PubChem (CID 159730608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).