C15H18ClN3O — CID 159732987
N-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-1H-indole-2-carboxamide;hydrochloride (PubChem CID 159732987) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is N-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 159732987 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(N[C@@H]1CC2CCC1N2)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H17N3O.ClH/c19-15(18-13-8-10-5-6-12(13)16-10)14-7-9-3-1-2-4-11(9)17-14;/h1-4,7,10,12-13,16-17H,5-6,8H2,(H,18,19);1H/t10?,12?,13-;/m1./s1 |
| InChIKey | VSRZUTLGTOGMHR-KVSYGULOSA-N |
| XLogP | 2.21 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |