C24H28N6O4 — CID 159733711
methyl N-[1-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-quinolin-7-yl]carbamate;7-nitro-1,2,3,4-tetrahydroquinoline (PubChem CID 159733711) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is methyl N-[1-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-quinolin-7-yl]carbamate;7-nitro-1,2,3,4-tetrahydroquinoline.
| Compound Name | methyl N-[1-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-quinolin-7-yl]carbamate;7-nitro-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 159733711 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | methyl N-[1-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-quinolin-7-yl]carbamate;7-nitro-1,2,3,4-tetrahydroquinoline |
| SMILES | COC(=O)Nc1ccc2c(c1)N(Cc1cnc[nH]1)CCC2.O=[N+]([O-])c1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C15H18N4O2.C9H10N2O2/c1-21-15(20)18-12-5-4-11-3-2-6-19(14(11)7-12)9-13-8-16-10-17-13;12-11(13)8-4-3-7-2-1-5-10-9(7)6-8/h4-5,7-8,10H,2-3,6,9H2,1H3,(H,16,17)(H,18,20);3-4,6,10H,1-2,5H2 |
| InChIKey | NBOFSVBFXOBZNX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|