C13H23N3O3 — CID 159734807
N-(3-morpholin-4-ylpropyl)prop-2-enamide;prop-2-enamide (PubChem CID 159734807) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)prop-2-enamide;prop-2-enamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)prop-2-enamide;prop-2-enamide |
|---|---|
| PubChem CID | 159734807 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)prop-2-enamide;prop-2-enamide |
| SMILES | C=CC(=O)NCCCN1CCOCC1.C=CC(N)=O |
| InChI | InChI=1S/C10H18N2O2.C3H5NO/c1-2-10(13)11-4-3-5-12-6-8-14-9-7-12;1-2-3(4)5/h2H,1,3-9H2,(H,11,13);2H,1H2,(H2,4,5) |
| InChIKey | NBRVBFAGKBRKNE-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|