C17H15F5N2O5 — CID 159735628
2-amino-5-fluorobenzoic acid;5-fluoro-2-[2-(trifluoromethoxy)ethylamino]benzoic acid (PubChem CID 159735628) has the molecular formula C17H15F5N2O5 and a molecular weight of 422.31 g/mol. Its IUPAC name is 2-amino-5-fluorobenzoic acid;5-fluoro-2-[2-(trifluoromethoxy)ethylamino]benzoic acid.
| Compound Name | 2-amino-5-fluorobenzoic acid;5-fluoro-2-[2-(trifluoromethoxy)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 159735628 |
| Molecular Formula | C17H15F5N2O5 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-amino-5-fluorobenzoic acid;5-fluoro-2-[2-(trifluoromethoxy)ethylamino]benzoic acid |
| SMILES | Nc1ccc(F)cc1C(=O)O.O=C(O)c1cc(F)ccc1NCCOC(F)(F)F |
| InChI | InChI=1S/C10H9F4NO3.C7H6FNO2/c11-6-1-2-8(7(5-6)9(16)17)15-3-4-18-10(12,13)14;8-4-1-2-6(9)5(3-4)7(10)11/h1-2,5,15H,3-4H2,(H,16,17);1-3H,9H2,(H,10,11) |
| InChIKey | NBULQDFQPDGLCX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|