C24H33ClN4O2 — CID 159736559
benzoyl chloride;(2R)-2-methylpiperazine;[(3R)-3-methylpiperazin-1-yl]-phenylmethanone (PubChem CID 159736559) has the molecular formula C24H33ClN4O2 and a molecular weight of 445.01 g/mol. Its IUPAC name is benzoyl chloride;(2R)-2-methylpiperazine;[(3R)-3-methylpiperazin-1-yl]-phenylmethanone.
| Compound Name | benzoyl chloride;(2R)-2-methylpiperazine;[(3R)-3-methylpiperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 159736559 |
| Molecular Formula | C24H33ClN4O2 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | benzoyl chloride;(2R)-2-methylpiperazine;[(3R)-3-methylpiperazin-1-yl]-phenylmethanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)CCN1.C[C@@H]1CNCCN1.O=C(Cl)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O.C7H5ClO.C5H12N2/c1-10-9-14(8-7-13-10)12(15)11-5-3-2-4-6-11;8-7(9)6-4-2-1-3-5-6;1-5-4-6-2-3-7-5/h2-6,10,13H,7-9H2,1H3;1-5H;5-7H,2-4H2,1H3/t10-;;5-/m1.1/s1 |
| InChIKey | NBXKOIHFCUIBPT-PKNPUJBMSA-N |
| XLogP | 2.75 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|