C26H22N2O4S2 — CID 159737343
3-methylsulfonyl-N-[2-oxo-3-[4-(3-phenylphenyl)-1,3-thiazol-2-yl]propyl]benzamide (PubChem CID 159737343) has the molecular formula C26H22N2O4S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 3-methylsulfonyl-N-[2-oxo-3-[4-(3-phenylphenyl)-1,3-thiazol-2-yl]propyl]benzamide.
| Compound Name | 3-methylsulfonyl-N-[2-oxo-3-[4-(3-phenylphenyl)-1,3-thiazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 159737343 |
| Molecular Formula | C26H22N2O4S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 3-methylsulfonyl-N-[2-oxo-3-[4-(3-phenylphenyl)-1,3-thiazol-2-yl]propyl]benzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)NCC(=O)Cc2nc(-c3cccc(-c4ccccc4)c3)cs2)c1 |
| InChI | InChI=1S/C26H22N2O4S2/c1-34(31,32)23-12-6-11-21(14-23)26(30)27-16-22(29)15-25-28-24(17-33-25)20-10-5-9-19(13-20)18-7-3-2-4-8-18/h2-14,17H,15-16H2,1H3,(H,27,30) |
| InChIKey | YAIHFYSKDNKQDK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |