C21H24O5 — CID 15973978
methyl (1R,2S,7S,13R)-9-(furan-3-yl)-2,7,13-trimethyl-4-oxo-10-oxatricyclo[5.3.3.01,6]trideca-5,8-diene-2-carboxylate (PubChem CID 15973978) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl (1R,2S,7S,13R)-9-(furan-3-yl)-2,7,13-trimethyl-4-oxo-10-oxatricyclo[5.3.3.01,6]trideca-5,8-diene-2-carboxylate.
| Compound Name | methyl (1R,2S,7S,13R)-9-(furan-3-yl)-2,7,13-trimethyl-4-oxo-10-oxatricyclo[5.3.3.01,6]trideca-5,8-diene-2-carboxylate |
|---|---|
| PubChem CID | 15973978 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | methyl (1R,2S,7S,13R)-9-(furan-3-yl)-2,7,13-trimethyl-4-oxo-10-oxatricyclo[5.3.3.01,6]trideca-5,8-diene-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC(=O)C=C2[C@]3(C)C=C(c4ccoc4)O[C@]21CC[C@H]3C |
| InChI | InChI=1S/C21H24O5/c1-13-5-7-21-17(9-15(22)10-20(21,3)18(23)24-4)19(13,2)11-16(26-21)14-6-8-25-12-14/h6,8-9,11-13H,5,7,10H2,1-4H3/t13-,19-,20-,21-/m1/s1 |
| InChIKey | VXAWMXLXZCKLAP-PJBPFLDMSA-N |
| XLogP | 3.90 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |