C9H13N6P — CID 159739917
phenylphosphane;1,3,5-triazine-2,4,6-triamine (PubChem CID 159739917) has the molecular formula C9H13N6P and a molecular weight of 236.22 g/mol. Its IUPAC name is phenylphosphane;1,3,5-triazine-2,4,6-triamine.
| Compound Name | phenylphosphane;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 159739917 |
| Molecular Formula | C9H13N6P |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | phenylphosphane;1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(N)n1.Pc1ccccc1 |
| InChI | InChI=1S/C6H7P.C3H6N6/c7-6-4-2-1-3-5-6;4-1-7-2(5)9-3(6)8-1/h1-5H,7H2;(H6,4,5,6,7,8,9) |
| InChIKey | NCHZSYFYQPCAMA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|