C28H32N4O6 — CID 15974665
[(3S,7R,13R)-3,7-dibenzyl-2,5,9,12-tetraoxo-1,4,8,11-tetrazabicyclo[11.3.0]hexadecan-10-yl] acetate (PubChem CID 15974665) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is [(3S,7R,13R)-3,7-dibenzyl-2,5,9,12-tetraoxo-1,4,8,11-tetrazabicyclo[11.3.0]hexadecan-10-yl] acetate.
| Compound Name | [(3S,7R,13R)-3,7-dibenzyl-2,5,9,12-tetraoxo-1,4,8,11-tetrazabicyclo[11.3.0]hexadecan-10-yl] acetate |
|---|---|
| PubChem CID | 15974665 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | [(3S,7R,13R)-3,7-dibenzyl-2,5,9,12-tetraoxo-1,4,8,11-tetrazabicyclo[11.3.0]hexadecan-10-yl] acetate |
| SMILES | CC(=O)OC1NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)C[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C28H32N4O6/c1-18(33)38-27-26(36)29-21(15-19-9-4-2-5-10-19)17-24(34)30-22(16-20-11-6-3-7-12-20)28(37)32-14-8-13-23(32)25(35)31-27/h2-7,9-12,21-23,27H,8,13-17H2,1H3,(H,29,36)(H,30,34)(H,31,35)/t21-,22+,23-,27?/m1/s1 |
| InChIKey | SYFBBRKNAXZGRZ-UXWJYDTRSA-N |
| XLogP | 0.84 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |