C38H37N3O2 — CID 159748333
3-(1H-indol-3-yl)-N-[(2-methoxyphenyl)methyl]-2-(tritylamino)propanamide;molecular hydrogen (PubChem CID 159748333) has the molecular formula C38H37N3O2 and a molecular weight of 567.73 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-N-[(2-methoxyphenyl)methyl]-2-(tritylamino)propanamide;molecular hydrogen.
| Compound Name | 3-(1H-indol-3-yl)-N-[(2-methoxyphenyl)methyl]-2-(tritylamino)propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 159748333 |
| Molecular Formula | C38H37N3O2 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | 3-(1H-indol-3-yl)-N-[(2-methoxyphenyl)methyl]-2-(tritylamino)propanamide;molecular hydrogen |
| SMILES | COc1ccccc1CNC(=O)C(Cc1c[nH]c2ccccc12)NC(c1ccccc1)(c1ccccc1)c1ccccc1.[H][H] |
| InChI | InChI=1S/C38H35N3O2.H2/c1-43-36-24-14-11-15-28(36)26-40-37(42)35(25-29-27-39-34-23-13-12-22-33(29)34)41-38(30-16-5-2-6-17-30,31-18-7-3-8-19-31)32-20-9-4-10-21-32;/h2-24,27,35,39,41H,25-26H2,1H3,(H,40,42);1H |
| InChIKey | OTSKJMAITIMUAC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|