C24H18FN5O2 — CID 159749508
(8S)-8-[(4-fluorophenyl)-(4-methylphenyl)methyl]-13-hydroxy-12-oxo-3,6,9,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraene-5-carbonitrile (PubChem CID 159749508) has the molecular formula C24H18FN5O2 and a molecular weight of 427.44 g/mol. Its IUPAC name is (8S)-8-[(4-fluorophenyl)-(4-methylphenyl)methyl]-13-hydroxy-12-oxo-3,6,9,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraene-5-carbonitrile.
| Compound Name | (8S)-8-[(4-fluorophenyl)-(4-methylphenyl)methyl]-13-hydroxy-12-oxo-3,6,9,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraene-5-carbonitrile |
|---|---|
| PubChem CID | 159749508 |
| Molecular Formula | C24H18FN5O2 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (8S)-8-[(4-fluorophenyl)-(4-methylphenyl)methyl]-13-hydroxy-12-oxo-3,6,9,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraene-5-carbonitrile |
| SMILES | Cc1ccc(C(c2ccc(F)cc2)[C@H]2Cn3c(C#N)cnc3-c3c(O)c(=O)cnn32)cc1 |
| InChI | InChI=1S/C24H18FN5O2/c1-14-2-4-15(5-3-14)21(16-6-8-17(25)9-7-16)19-13-29-18(10-26)11-27-24(29)22-23(32)20(31)12-28-30(19)22/h2-9,11-12,19,21,32H,13H2,1H3/t19-,21?/m1/s1 |
| InChIKey | IGGNYVIUHVFHBC-YMBRHYMPSA-N |
| XLogP | 3.52 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |