C23H18F3N3O3 — CID 134297953
(2S,3R)-2-[(R)-(3,4-difluorophenyl)-(4-fluorophenyl)methyl]-10-hydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione (PubChem CID 134297953) has the molecular formula C23H18F3N3O3 and a molecular weight of 441.41 g/mol. Its IUPAC name is (2S,3R)-2-[(R)-(3,4-difluorophenyl)-(4-fluorophenyl)methyl]-10-hydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione.
| Compound Name | (2S,3R)-2-[(R)-(3,4-difluorophenyl)-(4-fluorophenyl)methyl]-10-hydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
|---|---|
| PubChem CID | 134297953 |
| Molecular Formula | C23H18F3N3O3 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | (2S,3R)-2-[(R)-(3,4-difluorophenyl)-(4-fluorophenyl)methyl]-10-hydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
| SMILES | O=C1c2c(O)c(=O)cnn2[C@@H]([C@H](c2ccc(F)cc2)c2ccc(F)c(F)c2)[C@H]2CCCN12 |
| InChI | InChI=1S/C23H18F3N3O3/c24-14-6-3-12(4-7-14)19(13-5-8-15(25)16(26)10-13)20-17-2-1-9-28(17)23(32)21-22(31)18(30)11-27-29(20)21/h3-8,10-11,17,19-20,31H,1-2,9H2/t17-,19-,20-/m1/s1 |
| InChIKey | JOSHOUQBXXNNCW-MISYRCLQSA-N |
| XLogP | 3.36 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |