C23H19F2N3O3 — CID 134303412
(3R)-2-[bis(3-fluorophenyl)methyl]-10-hydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione (PubChem CID 134303412) has the molecular formula C23H19F2N3O3 and a molecular weight of 423.42 g/mol. Its IUPAC name is (3R)-2-[bis(3-fluorophenyl)methyl]-10-hydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione.
| Compound Name | (3R)-2-[bis(3-fluorophenyl)methyl]-10-hydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
|---|---|
| PubChem CID | 134303412 |
| Molecular Formula | C23H19F2N3O3 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (3R)-2-[bis(3-fluorophenyl)methyl]-10-hydroxy-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
| SMILES | O=C1c2c(O)c(=O)cnn2C(C(c2cccc(F)c2)c2cccc(F)c2)[C@H]2CCCN12 |
| InChI | InChI=1S/C23H19F2N3O3/c24-15-6-1-4-13(10-15)19(14-5-2-7-16(25)11-14)20-17-8-3-9-27(17)23(31)21-22(30)18(29)12-26-28(20)21/h1-2,4-7,10-12,17,19-20,30H,3,8-9H2/t17-,20?/m1/s1 |
| InChIKey | URUOBFGJXHCESZ-DIAVIDTQSA-N |
| XLogP | 3.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |