C25H20F3N3O4 — CID 155434224
[(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] acetate (PubChem CID 155434224) has the molecular formula C25H20F3N3O4 and a molecular weight of 483.45 g/mol. Its IUPAC name is [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] acetate.
| Compound Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] acetate |
|---|---|
| PubChem CID | 155434224 |
| Molecular Formula | C25H20F3N3O4 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] acetate |
| SMILES | CC(=O)Oc1c2n(ncc1=O)[C@@H]([C@H](c1cccc(F)c1)c1cccc(F)c1F)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C25H20F3N3O4/c1-13(32)35-24-19(33)12-29-31-22(18-9-4-10-30(18)25(34)23(24)31)20(14-5-2-6-15(26)11-14)16-7-3-8-17(27)21(16)28/h2-3,5-8,11-12,18,20,22H,4,9-10H2,1H3/t18-,20-,22-/m1/s1 |
| InChIKey | WXZFARJWNJOSHR-SYYKKAFVSA-N |
| XLogP | 3.58 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |