C29H30F2N4O5 — CID 155434225
[(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 2-amino-3-methylbutanoate (PubChem CID 155434225) has the molecular formula C29H30F2N4O5 and a molecular weight of 552.58 g/mol. Its IUPAC name is [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 2-amino-3-methylbutanoate.
| Compound Name | [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 155434225 |
| Molecular Formula | C29H30F2N4O5 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)OCOc1c2n(ncc1=O)[C@@H](C(c1ccccc1)c1cccc(F)c1F)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C29H30F2N4O5/c1-16(2)24(32)29(38)40-15-39-27-21(36)14-33-35-25(20-12-7-13-34(20)28(37)26(27)35)22(17-8-4-3-5-9-17)18-10-6-11-19(30)23(18)31/h3-6,8-11,14,16,20,22,24-25H,7,12-13,15,32H2,1-2H3/t20-,22?,24?,25-/m1/s1 |
| InChIKey | CCRRLEREWKQAES-JCNAJNKASA-N |
| XLogP | 3.38 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|