C27H24F3N3O4 — CID 155434138
[(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 2-methylpropanoate (PubChem CID 155434138) has the molecular formula C27H24F3N3O4 and a molecular weight of 511.50 g/mol. Its IUPAC name is [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 2-methylpropanoate.
| Compound Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 155434138 |
| Molecular Formula | C27H24F3N3O4 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1c2n(ncc1=O)[C@@H]([C@H](c1cccc(F)c1)c1cccc(F)c1F)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C27H24F3N3O4/c1-14(2)27(36)37-25-20(34)13-31-33-23(19-10-5-11-32(19)26(35)24(25)33)21(15-6-3-7-16(28)12-15)17-8-4-9-18(29)22(17)30/h3-4,6-9,12-14,19,21,23H,5,10-11H2,1-2H3/t19-,21-,23-/m1/s1 |
| InChIKey | MIRHCGXKLUCZJG-KJXAQDMKSA-N |
| XLogP | 4.21 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |