C28H26F3N3O4 — CID 155434117
[(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(4-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 3-methylbutanoate (PubChem CID 155434117) has the molecular formula C28H26F3N3O4 and a molecular weight of 525.53 g/mol. Its IUPAC name is [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(4-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 3-methylbutanoate.
| Compound Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(4-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 155434117 |
| Molecular Formula | C28H26F3N3O4 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(4-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)Oc1c2n(ncc1=O)[C@@H]([C@H](c1ccc(F)cc1)c1cccc(F)c1F)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C28H26F3N3O4/c1-15(2)13-22(36)38-27-21(35)14-32-34-25(20-7-4-12-33(20)28(37)26(27)34)23(16-8-10-17(29)11-9-16)18-5-3-6-19(30)24(18)31/h3,5-6,8-11,14-15,20,23,25H,4,7,12-13H2,1-2H3/t20-,23-,25-/m1/s1 |
| InChIKey | HWORONSVHPFBIY-QFZRFWILSA-N |
| XLogP | 4.60 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |