C29H29F2N3O4 — CID 158921978
[(2S,3R)-2-[(R)-(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 3,3-dimethylbutanoate (PubChem CID 158921978) has the molecular formula C29H29F2N3O4 and a molecular weight of 521.56 g/mol. Its IUPAC name is [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 3,3-dimethylbutanoate.
| Compound Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 158921978 |
| Molecular Formula | C29H29F2N3O4 |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)Oc1c2n(ncc1=O)[C@@H]([C@H](c1ccccc1)c1cccc(F)c1F)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C29H29F2N3O4/c1-29(2,3)15-22(36)38-27-21(35)16-32-34-25(20-13-8-14-33(20)28(37)26(27)34)23(17-9-5-4-6-10-17)18-11-7-12-19(30)24(18)31/h4-7,9-12,16,20,23,25H,8,13-15H2,1-3H3/t20-,23-,25-/m1/s1 |
| InChIKey | JHYDEECYVRYMSG-QFZRFWILSA-N |
| XLogP | 4.85 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |