C28H27F2N3O6 — CID 155434279
[(2S,3R)-2-[(R)-(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 3-methoxypropanoate (PubChem CID 155434279) has the molecular formula C28H27F2N3O6 and a molecular weight of 539.54 g/mol. Its IUPAC name is [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 3-methoxypropanoate.
| Compound Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 3-methoxypropanoate |
|---|---|
| PubChem CID | 155434279 |
| Molecular Formula | C28H27F2N3O6 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 3-methoxypropanoate |
| SMILES | COCCC(=O)OCOc1c2n(ncc1=O)[C@@H]([C@H](c1ccccc1)c1cccc(F)c1F)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C28H27F2N3O6/c1-37-14-12-22(35)38-16-39-27-21(34)15-31-33-25(20-11-6-13-32(20)28(36)26(27)33)23(17-7-3-2-4-8-17)18-9-5-10-19(29)24(18)30/h2-5,7-10,15,20,23,25H,6,11-14,16H2,1H3/t20-,23-,25-/m1/s1 |
| InChIKey | LQCNOZSKDPSCAP-QFZRFWILSA-N |
| XLogP | 3.43 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|